C14H26N2O5 — CID 71097600
tert-butyl N-[(1R,2R,4S)-4-carbamoyl-2-(2-hydroxypropan-2-yloxy)cyclopentyl]carbamate (PubChem CID 71097600) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,4S)-4-carbamoyl-2-(2-hydroxypropan-2-yloxy)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,4S)-4-carbamoyl-2-(2-hydroxypropan-2-yloxy)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 71097600 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | tert-butyl N-[(1R,2R,4S)-4-carbamoyl-2-(2-hydroxypropan-2-yloxy)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](C(N)=O)C[C@H]1OC(C)(C)O |
| InChI | InChI=1S/C14H26N2O5/c1-13(2,3)21-12(18)16-9-6-8(11(15)17)7-10(9)20-14(4,5)19/h8-10,19H,6-7H2,1-5H3,(H2,15,17)(H,16,18)/t8-,9+,10+/m0/s1 |
| InChIKey | DFSVUWRNJXHCCJ-IVZWLZJFSA-N |
| XLogP | 0.89 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|