C32H26ClF3N2O — CID 71099293
N-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide (PubChem CID 71099293) has the molecular formula C32H26ClF3N2O and a molecular weight of 547.02 g/mol. Its IUPAC name is N-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide.
| Compound Name | N-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71099293 |
| Molecular Formula | C32H26ClF3N2O |
| Molecular Weight | 547.02 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | N-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)NCc3ccc(Cl)cc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C32H26ClF3N2O/c1-20-21(2)38(19-22-8-10-24(11-9-22)23-6-4-3-5-7-23)30-15-13-25(16-28(20)30)31(39)37-18-26-12-14-27(33)17-29(26)32(34,35)36/h3-17H,18-19H2,1-2H3,(H,37,39) |
| InChIKey | WPZBJNHPTHQROD-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.02 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|