C21H21ClN6OS — CID 71101708
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-(8-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone (PubChem CID 71101708) has the molecular formula C21H21ClN6OS and a molecular weight of 440.96 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-(8-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-(8-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone |
|---|---|
| PubChem CID | 71101708 |
| Molecular Formula | C21H21ClN6OS |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-(8-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone |
| SMILES | Cc1ccc2c(c1)C1CNCCC1N2C(=O)CSc1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN6OS/c1-13-2-7-18-16(10-13)17-11-23-9-8-19(17)27(18)20(29)12-30-21-24-25-26-28(21)15-5-3-14(22)4-6-15/h2-7,10,17,19,23H,8-9,11-12H2,1H3 |
| InChIKey | KCPPYTYNCWMYHI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |