C21H23N5O6 — CID 71111401
2-tert-butyl-4-[3-cyano-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 71111401) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-tert-butyl-4-[3-cyano-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[3-cyano-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 71111401 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-tert-butyl-4-[3-cyano-1-(4-nitrophenyl)-6-oxopyridazin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CC(Oc2cc(=O)n(-c3ccc([N+](=O)[O-])cc3)nc2C#N)CCN1C(=O)O |
| InChI | InChI=1S/C21H23N5O6/c1-21(2,3)18-10-15(8-9-24(18)20(28)29)32-17-11-19(27)25(23-16(17)12-22)13-4-6-14(7-5-13)26(30)31/h4-7,11,15,18H,8-10H2,1-3H3,(H,28,29) |
| InChIKey | FTTCFTVOBOHLSD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|