C15H22AsN3O3 — CID 87700941
CID 87700941 (PubChem CID 87700941) has the molecular formula C15H22AsN3O3 and a molecular weight of 367.28 g/mol.
| Compound Name | CID 87700941 |
|---|---|
| PubChem CID | 87700941 |
| Molecular Formula | C15H22AsN3O3 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | — |
| SMILES | Cc1nc([As])cc(OC2CCN(C(=O)O)C(C(C)(C)C)C2)n1 |
| InChI | InChI=1S/C15H22AsN3O3/c1-9-17-12(16)8-13(18-9)22-10-5-6-19(14(20)21)11(7-10)15(2,3)4/h8,10-11H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | DZBLORVJTBSYHG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|