C16H23N2O3- — CID 53439119
4-(3-aminophenoxy)-2-tert-butylpiperidine-1-carboxylate (PubChem CID 53439119) has the molecular formula C16H23N2O3- and a molecular weight of 291.37 g/mol. Its IUPAC name is 4-(3-aminophenoxy)-2-tert-butylpiperidine-1-carboxylate.
| Compound Name | 4-(3-aminophenoxy)-2-tert-butylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 53439119 |
| Molecular Formula | C16H23N2O3- |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 4-(3-aminophenoxy)-2-tert-butylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)C1CC(Oc2cccc(N)c2)CCN1C(=O)[O-] |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)14-10-13(7-8-18(14)15(19)20)21-12-6-4-5-11(17)9-12/h4-6,9,13-14H,7-8,10,17H2,1-3H3,(H,19,20)/p-1 |
| InChIKey | XWXAYHNMDRHAQS-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|