C23H20O4 — CID 71113242
[3-[[4-(1,3-dioxolan-2-yl)phenyl]methoxy]phenyl]-phenylmethanone (PubChem CID 71113242) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is [3-[[4-(1,3-dioxolan-2-yl)phenyl]methoxy]phenyl]-phenylmethanone.
| Compound Name | [3-[[4-(1,3-dioxolan-2-yl)phenyl]methoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 71113242 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [3-[[4-(1,3-dioxolan-2-yl)phenyl]methoxy]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cccc(OCc2ccc(C3OCCO3)cc2)c1 |
| InChI | InChI=1S/C23H20O4/c24-22(18-5-2-1-3-6-18)20-7-4-8-21(15-20)27-16-17-9-11-19(12-10-17)23-25-13-14-26-23/h1-12,15,23H,13-14,16H2 |
| InChIKey | ABLDTAQQJBOJNZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |