C16H14O3 — CID 24726701
[4-(1,3-dioxolan-2-yl)phenyl]-phenylmethanone (PubChem CID 24726701) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is [4-(1,3-dioxolan-2-yl)phenyl]-phenylmethanone.
| Compound Name | [4-(1,3-dioxolan-2-yl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 24726701 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [4-(1,3-dioxolan-2-yl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C16H14O3/c17-15(12-4-2-1-3-5-12)13-6-8-14(9-7-13)16-18-10-11-19-16/h1-9,16H,10-11H2 |
| InChIKey | QHYFENSENCKTMG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |