C26H11N5O3S — CID 71113526
21-thiophen-2-yl-3,7,10,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione (PubChem CID 71113526) has the molecular formula C26H11N5O3S and a molecular weight of 473.47 g/mol. Its IUPAC name is 21-thiophen-2-yl-3,7,10,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione.
| Compound Name | 21-thiophen-2-yl-3,7,10,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione |
|---|---|
| PubChem CID | 71113526 |
| Molecular Formula | C26H11N5O3S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 21-thiophen-2-yl-3,7,10,14,21-pentazaheptacyclo[17.6.2.02,14.04,13.06,11.016,26.023,27]heptacosa-1(26),2,4,6,8,10,12,16,18,23(27),24-undecaene-15,20,22-trione |
| SMILES | O=C1c2ccc3c(=O)n4c5cc6nccnc6cc5nc4c4ccc(c2c34)C(=O)N1c1cccs1 |
| InChI | InChI=1S/C26H11N5O3S/c32-24-13-5-6-15-22-14(25(33)31(26(15)34)20-2-1-9-35-20)4-3-12(21(13)22)23-29-18-10-16-17(28-8-7-27-16)11-19(18)30(23)24/h1-11H |
| InChIKey | IUKWAMNJMJPFBB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|