C24H30N2O5 — CID 71114157
5,6-dimethoxy-2-[[1-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one (PubChem CID 71114157) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 5,6-dimethoxy-2-[[1-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one.
| Compound Name | 5,6-dimethoxy-2-[[1-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 71114157 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5,6-dimethoxy-2-[[1-[(3-nitrocyclohexa-2,4-dien-1-yl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1CCN(CC3C=C([N+](=O)[O-])C=CC3)CC1)C2 |
| InChI | InChI=1S/C24H30N2O5/c1-30-22-13-18-12-19(24(27)21(18)14-23(22)31-2)10-16-6-8-25(9-7-16)15-17-4-3-5-20(11-17)26(28)29/h3,5,11,13-14,16-17,19H,4,6-10,12,15H2,1-2H3 |
| InChIKey | PYJSIZUFVSLWFC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|