C22H41NO5S — CID 71116033
tert-butyl 4-hydroxy-2,2-dimethyl-6-(nonylsulfanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 71116033) has the molecular formula C22H41NO5S and a molecular weight of 431.64 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-2,2-dimethyl-6-(nonylsulfanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-2,2-dimethyl-6-(nonylsulfanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 71116033 |
| Molecular Formula | C22H41NO5S |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | tert-butyl 4-hydroxy-2,2-dimethyl-6-(nonylsulfanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCCCCCCCCSCC1C2OC(C)(C)OC2C(O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H41NO5S/c1-7-8-9-10-11-12-13-14-29-15-16-17-18(27-22(5,6)26-17)19(24)23(16)20(25)28-21(2,3)4/h16-19,24H,7-15H2,1-6H3 |
| InChIKey | SHLALNBWAWFLJM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|