C19H33N — CID 71119975
(4R)-6-[(Z)-2-(2,4-dimethylcyclobutyl)ethenyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine (PubChem CID 71119975) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is (4R)-6-[(Z)-2-(2,4-dimethylcyclobutyl)ethenyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine.
| Compound Name | (4R)-6-[(Z)-2-(2,4-dimethylcyclobutyl)ethenyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine |
|---|---|
| PubChem CID | 71119975 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (4R)-6-[(Z)-2-(2,4-dimethylcyclobutyl)ethenyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine |
| SMILES | CC1=C(/C=C\C2C(C)CC2C)C(C)(C)[C@H](C)CCN1C |
| InChI | InChI=1S/C19H33N/c1-13-12-14(2)17(13)8-9-18-16(4)20(7)11-10-15(3)19(18,5)6/h8-9,13-15,17H,10-12H2,1-7H3/b9-8-/t13?,14?,15-,17?/m1/s1 |
| InChIKey | GYNPSJAMEIIQLF-PFHHJSNVSA-N |
| XLogP | 5.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |