C17H19N5O3 — CID 71120257
4-[[3-(pyridine-2-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylic acid (PubChem CID 71120257) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-[[3-(pyridine-2-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[3-(pyridine-2-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 71120257 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-[[3-(pyridine-2-carbonylamino)-2-pyridinyl]amino]piperidine-1-carboxylic acid |
| SMILES | O=C(Nc1cccnc1NC1CCN(C(=O)O)CC1)c1ccccn1 |
| InChI | InChI=1S/C17H19N5O3/c23-16(14-4-1-2-8-18-14)21-13-5-3-9-19-15(13)20-12-6-10-22(11-7-12)17(24)25/h1-5,8-9,12H,6-7,10-11H2,(H,19,20)(H,21,23)(H,24,25) |
| InChIKey | FKWGWPAHXDVYFU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |