C12H17N5O2S — CID 88753374
4-[(2-amino-3-pyridinyl)carbamothioylamino]piperidine-1-carboxylic acid (PubChem CID 88753374) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 4-[(2-amino-3-pyridinyl)carbamothioylamino]piperidine-1-carboxylic acid.
| Compound Name | 4-[(2-amino-3-pyridinyl)carbamothioylamino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 88753374 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-[(2-amino-3-pyridinyl)carbamothioylamino]piperidine-1-carboxylic acid |
| SMILES | Nc1ncccc1NC(=S)NC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C12H17N5O2S/c13-10-9(2-1-5-14-10)16-11(20)15-8-3-6-17(7-4-8)12(18)19/h1-2,5,8H,3-4,6-7H2,(H2,13,14)(H,18,19)(H2,15,16,20) |
| InChIKey | MOMBZXKCMLKOKI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|