C13H17ClN4O2S — CID 88752482
4-[(2-amino-5-chlorophenyl)carbamothioylamino]piperidine-1-carboxylic acid (PubChem CID 88752482) has the molecular formula C13H17ClN4O2S and a molecular weight of 328.83 g/mol. Its IUPAC name is 4-[(2-amino-5-chlorophenyl)carbamothioylamino]piperidine-1-carboxylic acid.
| Compound Name | 4-[(2-amino-5-chlorophenyl)carbamothioylamino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 88752482 |
| Molecular Formula | C13H17ClN4O2S |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 4-[(2-amino-5-chlorophenyl)carbamothioylamino]piperidine-1-carboxylic acid |
| SMILES | Nc1ccc(Cl)cc1NC(=S)NC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C13H17ClN4O2S/c14-8-1-2-10(15)11(7-8)17-12(21)16-9-3-5-18(6-4-9)13(19)20/h1-2,7,9H,3-6,15H2,(H,19,20)(H2,16,17,21) |
| InChIKey | BFHDESXKUCXZRR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|