C15H20N4O5 — CID 175928078
4-[[3-[(2-ethoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]piperidine-1-carboxylic acid (PubChem CID 175928078) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-[[3-[(2-ethoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[3-[(2-ethoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175928078 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[[3-[(2-ethoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C(=O)Nc1cccnc1NC1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C15H20N4O5/c1-2-24-14(21)13(20)18-11-4-3-7-16-12(11)17-10-5-8-19(9-6-10)15(22)23/h3-4,7,10H,2,5-6,8-9H2,1H3,(H,16,17)(H,18,20)(H,22,23) |
| InChIKey | REZQDQCGFIVTCC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|