C18H22N4O2 — CID 87053000
[4-[(3-ethoxypyrazin-2-yl)amino]piperidin-1-yl]-phenylmethanone (PubChem CID 87053000) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is [4-[(3-ethoxypyrazin-2-yl)amino]piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[(3-ethoxypyrazin-2-yl)amino]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 87053000 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [4-[(3-ethoxypyrazin-2-yl)amino]piperidin-1-yl]-phenylmethanone |
| SMILES | CCOc1nccnc1NC1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-24-17-16(19-10-11-20-17)21-15-8-12-22(13-9-15)18(23)14-6-4-3-5-7-14/h3-7,10-11,15H,2,8-9,12-13H2,1H3,(H,19,21) |
| InChIKey | QBJPVGLVSTUCDM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |