C30H35N3O2 — CID 71121367
tert-butyl 4-[9-[(2-methylimidazol-1-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]piperidine-1-carboxylate (PubChem CID 71121367) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is tert-butyl 4-[9-[(2-methylimidazol-1-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[9-[(2-methylimidazol-1-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71121367 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | tert-butyl 4-[9-[(2-methylimidazol-1-yl)methyl]-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]piperidine-1-carboxylate |
| SMILES | Cc1nccn1CC1=Cc2ccccc2C(C2CCN(C(=O)OC(C)(C)C)CC2)c2ccccc21 |
| InChI | InChI=1S/C30H35N3O2/c1-21-31-15-18-33(21)20-24-19-23-9-5-6-11-26(23)28(27-12-8-7-10-25(24)27)22-13-16-32(17-14-22)29(34)35-30(2,3)4/h5-12,15,18-19,22,28H,13-14,16-17,20H2,1-4H3 |
| InChIKey | WAKLUXYTATVRGX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|