C24H21NO4 — CID 71121805
5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]isoindole-1,3-dione (PubChem CID 71121805) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]isoindole-1,3-dione.
| Compound Name | 5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71121805 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 5-[4-[2-(4-methoxyphenyl)propan-2-yl]phenoxy]isoindole-1,3-dione |
| SMILES | COc1ccc(C(C)(C)c2ccc(Oc3ccc4c(c3)C(=O)NC4=O)cc2)cc1 |
| InChI | InChI=1S/C24H21NO4/c1-24(2,15-4-8-17(28-3)9-5-15)16-6-10-18(11-7-16)29-19-12-13-20-21(14-19)23(27)25-22(20)26/h4-14H,1-3H3,(H,25,26,27) |
| InChIKey | OOFSNSJSAHAGME-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|