About 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione
5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione (PubChem CID 71122179) has the molecular formula C6H8N2O2S2
and a molecular weight of 204.28 g/mol. Its IUPAC name is 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione.
Molecular Properties
| Compound Name | 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione |
| PubChem CID | 71122179 |
| Molecular Formula | C6H8N2O2S2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione |
| SMILES | S=c1nc(OC2CCOC2)s[nH]1 |
| InChI | InChI=1S/C6H8N2O2S2/c11-5-7-6(12-8-5)10-4-1-2-9-3-4/h4H,1-3H2,(H,8,11) |
| InChIKey | JZVJVFQUCGSPTN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione?
The IUPAC name of 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione (CID 71122179) is 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione.
What is the SMILES notation for 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione?
The canonical SMILES for 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione is S=c1nc(OC2CCOC2)s[nH]1.
What is the InChIKey of 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione?
The InChIKey is JZVJVFQUCGSPTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S2/c11-5-7-6(12-8-5)10-4-1-2-9-3-4/h4H,1-3H2,(H,8,11).
What are the key properties of 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione?
5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione has a molecular weight of 204.28 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxolan-3-yloxy)-1,2,4-thiadiazole-3-thione is sourced from PubChem (CID 71122179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).