C28H37N7O3 — CID 71123034
tert-butyl 4-[3-amino-5-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1H-pyrrol-2-yl]piperazine-1-carboxylate (PubChem CID 71123034) has the molecular formula C28H37N7O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-5-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1H-pyrrol-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-5-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1H-pyrrol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71123034 |
| Molecular Formula | C28H37N7O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | tert-butyl 4-[3-amino-5-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1H-pyrrol-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2[nH]c(-c3ccnc(Nc4ccc(N5CCOCC5)cc4)c3)cc2N)CC1 |
| InChI | InChI=1S/C28H37N7O3/c1-28(2,3)38-27(36)35-12-10-34(11-13-35)26-23(29)19-24(32-26)20-8-9-30-25(18-20)31-21-4-6-22(7-5-21)33-14-16-37-17-15-33/h4-9,18-19,32H,10-17,29H2,1-3H3,(H,30,31) |
| InChIKey | UXRWGVQTYUORNS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|