C26H37N7O3S — CID 129245765
tert-butyl 4-[[2-[(2-amino-4-morpholin-4-ylphenyl)carbamothioylamino]-4-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 129245765) has the molecular formula C26H37N7O3S and a molecular weight of 527.70 g/mol. Its IUPAC name is tert-butyl 4-[[2-[(2-amino-4-morpholin-4-ylphenyl)carbamothioylamino]-4-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[(2-amino-4-morpholin-4-ylphenyl)carbamothioylamino]-4-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129245765 |
| Molecular Formula | C26H37N7O3S |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | tert-butyl 4-[[2-[(2-amino-4-morpholin-4-ylphenyl)carbamothioylamino]-4-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccnc(NC(=S)Nc3ccc(N4CCOCC4)cc3N)c2)CC1 |
| InChI | InChI=1S/C26H37N7O3S/c1-26(2,3)36-25(34)33-10-8-31(9-11-33)18-19-6-7-28-23(16-19)30-24(37)29-22-5-4-20(17-21(22)27)32-12-14-35-15-13-32/h4-7,16-17H,8-15,18,27H2,1-3H3,(H2,28,29,30,37) |
| InChIKey | VNTONVHZYZDIBB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|