C28H41N3O2 — CID 71124652
N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide (PubChem CID 71124652) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide.
| Compound Name | N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 71124652 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCC2CN(C(C)c3ccc(OCCCCN(C)C)c(C)c3C)C2)c1 |
| InChI | InChI=1S/C28H41N3O2/c1-20-10-9-11-25(16-20)28(32)29-17-24-18-31(19-24)23(4)26-12-13-27(22(3)21(26)2)33-15-8-7-14-30(5)6/h9-13,16,23-24H,7-8,14-15,17-19H2,1-6H3,(H,29,32) |
| InChIKey | FDBMXPVEJZFMIN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|