C28H40ClN3O2 — CID 71124909
4-chloro-N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide (PubChem CID 71124909) has the molecular formula C28H40ClN3O2 and a molecular weight of 486.10 g/mol. Its IUPAC name is 4-chloro-N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide.
| Compound Name | 4-chloro-N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 71124909 |
| Molecular Formula | C28H40ClN3O2 |
| Molecular Weight | 486.10 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 4-chloro-N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCC2CN(C(C)c3ccc(OCCCCN(C)C)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C28H40ClN3O2/c1-19-15-24(9-11-26(19)29)28(33)30-16-23-17-32(18-23)22(4)25-10-12-27(21(3)20(25)2)34-14-8-7-13-31(5)6/h9-12,15,22-23H,7-8,13-14,16-18H2,1-6H3,(H,30,33) |
| InChIKey | KKINGHORZLLLSR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.10 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|