C30H44FN3O3 — CID 143623007
N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]piperidin-3-yl]methyl]-3-fluoro-4-methoxybenzamide (PubChem CID 143623007) has the molecular formula C30H44FN3O3 and a molecular weight of 513.70 g/mol. Its IUPAC name is N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]piperidin-3-yl]methyl]-3-fluoro-4-methoxybenzamide.
| Compound Name | N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]piperidin-3-yl]methyl]-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 143623007 |
| Molecular Formula | C30H44FN3O3 |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.34 |
| IUPAC Name | N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]piperidin-3-yl]methyl]-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2CCCN(C(C)c3ccc(OCCCCN(C)C)c(C)c3C)C2)cc1F |
| InChI | InChI=1S/C30H44FN3O3/c1-21-22(2)28(37-17-8-7-15-33(4)5)14-12-26(21)23(3)34-16-9-10-24(20-34)19-32-30(35)25-11-13-29(36-6)27(31)18-25/h11-14,18,23-24H,7-10,15-17,19-20H2,1-6H3,(H,32,35) |
| InChIKey | YHGVVDLFBAQOKT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|