C27H37F2N3O2 — CID 71124750
N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-2,5-difluorobenzamide (PubChem CID 71124750) has the molecular formula C27H37F2N3O2 and a molecular weight of 473.61 g/mol. Its IUPAC name is N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-2,5-difluorobenzamide.
| Compound Name | N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 71124750 |
| Molecular Formula | C27H37F2N3O2 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | N-[[1-[1-[4-[4-(dimethylamino)butoxy]-2,3-dimethylphenyl]ethyl]azetidin-3-yl]methyl]-2,5-difluorobenzamide |
| SMILES | Cc1c(OCCCCN(C)C)ccc(C(C)N2CC(CNC(=O)c3cc(F)ccc3F)C2)c1C |
| InChI | InChI=1S/C27H37F2N3O2/c1-18-19(2)26(34-13-7-6-12-31(4)5)11-9-23(18)20(3)32-16-21(17-32)15-30-27(33)24-14-22(28)8-10-25(24)29/h8-11,14,20-21H,6-7,12-13,15-17H2,1-5H3,(H,30,33) |
| InChIKey | WEWJDDJKMHISJL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|