C26H36F3N3O2S — CID 143623327
N-[[1-[1-[2,3-dimethyl-4-[4-[methyl(trifluoromethyl)amino]butoxy]phenyl]ethyl]azetidin-3-yl]methyl]-5-methylthiophene-2-carboxamide (PubChem CID 143623327) has the molecular formula C26H36F3N3O2S and a molecular weight of 511.65 g/mol. Its IUPAC name is N-[[1-[1-[2,3-dimethyl-4-[4-[methyl(trifluoromethyl)amino]butoxy]phenyl]ethyl]azetidin-3-yl]methyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[[1-[1-[2,3-dimethyl-4-[4-[methyl(trifluoromethyl)amino]butoxy]phenyl]ethyl]azetidin-3-yl]methyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 143623327 |
| Molecular Formula | C26H36F3N3O2S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | N-[[1-[1-[2,3-dimethyl-4-[4-[methyl(trifluoromethyl)amino]butoxy]phenyl]ethyl]azetidin-3-yl]methyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC2CN(C(C)c3ccc(OCCCCN(C)C(F)(F)F)c(C)c3C)C2)s1 |
| InChI | InChI=1S/C26H36F3N3O2S/c1-17-8-11-24(35-17)25(33)30-14-21-15-32(16-21)20(4)22-9-10-23(19(3)18(22)2)34-13-7-6-12-31(5)26(27,28)29/h8-11,20-21H,6-7,12-16H2,1-5H3,(H,30,33) |
| InChIKey | YVXBRTIFBHCOKJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|