C17H25FIN3O — CID 86949707
N-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]methyl]-5-fluoro-2-iodobenzamide (PubChem CID 86949707) has the molecular formula C17H25FIN3O and a molecular weight of 433.31 g/mol. Its IUPAC name is N-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]methyl]-5-fluoro-2-iodobenzamide.
| Compound Name | N-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]methyl]-5-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 86949707 |
| Molecular Formula | C17H25FIN3O |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[[1-[2-(dimethylamino)ethyl]piperidin-4-yl]methyl]-5-fluoro-2-iodobenzamide |
| SMILES | CN(C)CCN1CCC(CNC(=O)c2cc(F)ccc2I)CC1 |
| InChI | InChI=1S/C17H25FIN3O/c1-21(2)9-10-22-7-5-13(6-8-22)12-20-17(23)15-11-14(18)3-4-16(15)19/h3-4,11,13H,5-10,12H2,1-2H3,(H,20,23) |
| InChIKey | HXIAFJBCJOWWLK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|