C18H14F2N4O2 — CID 71128082
2-fluoro-N-[7-(5-fluoro-4-methyl-3-pyridinyl)-6-oxido-2,6-naphthyridin-6-ium-3-yl]cyclopropane-1-carboxamide (PubChem CID 71128082) has the molecular formula C18H14F2N4O2 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-fluoro-N-[7-(5-fluoro-4-methyl-3-pyridinyl)-6-oxido-2,6-naphthyridin-6-ium-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 2-fluoro-N-[7-(5-fluoro-4-methyl-3-pyridinyl)-6-oxido-2,6-naphthyridin-6-ium-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71128082 |
| Molecular Formula | C18H14F2N4O2 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-fluoro-N-[7-(5-fluoro-4-methyl-3-pyridinyl)-6-oxido-2,6-naphthyridin-6-ium-3-yl]cyclopropane-1-carboxamide |
| SMILES | Cc1c(F)cncc1-c1cc2cnc(NC(=O)C3CC3F)cc2c[n+]1[O-] |
| InChI | InChI=1S/C18H14F2N4O2/c1-9-13(6-21-7-15(9)20)16-2-10-5-22-17(3-11(10)8-24(16)26)23-18(25)12-4-14(12)19/h2-3,5-8,12,14H,4H2,1H3,(H,22,23,25) |
| InChIKey | CKFKKGDOSWBOHE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|