C21H30FN7O — CID 71128910
4-[[4-(cyclohexylmethylamino)-6-[(1-methylpyrrolidin-2-yl)amino]-1,3,5-triazin-2-yl]amino]-2-fluorophenol (PubChem CID 71128910) has the molecular formula C21H30FN7O and a molecular weight of 415.52 g/mol. Its IUPAC name is 4-[[4-(cyclohexylmethylamino)-6-[(1-methylpyrrolidin-2-yl)amino]-1,3,5-triazin-2-yl]amino]-2-fluorophenol.
| Compound Name | 4-[[4-(cyclohexylmethylamino)-6-[(1-methylpyrrolidin-2-yl)amino]-1,3,5-triazin-2-yl]amino]-2-fluorophenol |
|---|---|
| PubChem CID | 71128910 |
| Molecular Formula | C21H30FN7O |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 4-[[4-(cyclohexylmethylamino)-6-[(1-methylpyrrolidin-2-yl)amino]-1,3,5-triazin-2-yl]amino]-2-fluorophenol |
| SMILES | CN1CCCC1Nc1nc(NCC2CCCCC2)nc(Nc2ccc(O)c(F)c2)n1 |
| InChI | InChI=1S/C21H30FN7O/c1-29-11-5-8-18(29)25-21-27-19(23-13-14-6-3-2-4-7-14)26-20(28-21)24-15-9-10-17(30)16(22)12-15/h9-10,12,14,18,30H,2-8,11,13H2,1H3,(H3,23,24,25,26,27,28) |
| InChIKey | JPUNYRXLCPZAHF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|