C12H15BrN4O2 — CID 71129506
2-amino-6-bromo-8-(2-ethoxyethyl)-4-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 71129506) has the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 2-amino-6-bromo-8-(2-ethoxyethyl)-4-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-6-bromo-8-(2-ethoxyethyl)-4-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 71129506 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-amino-6-bromo-8-(2-ethoxyethyl)-4-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCOCCn1c(=O)c(Br)cc2c(C)nc(N)nc21 |
| InChI | InChI=1S/C12H15BrN4O2/c1-3-19-5-4-17-10-8(6-9(13)11(17)18)7(2)15-12(14)16-10/h6H,3-5H2,1-2H3,(H2,14,15,16) |
| InChIKey | PYBKIGDLSDUZIB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|