C23H33B2N2O7P — CID 71134767
[4-[[3-[3-[(4-boronobenzoyl)amino]-3-methylbutoxy]-3-phosphanylbutyl]carbamoyl]phenyl]boronic acid (PubChem CID 71134767) has the molecular formula C23H33B2N2O7P and a molecular weight of 502.12 g/mol. Its IUPAC name is [4-[[3-[3-[(4-boronobenzoyl)amino]-3-methylbutoxy]-3-phosphanylbutyl]carbamoyl]phenyl]boronic acid.
| Compound Name | [4-[[3-[3-[(4-boronobenzoyl)amino]-3-methylbutoxy]-3-phosphanylbutyl]carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 71134767 |
| Molecular Formula | C23H33B2N2O7P |
| Molecular Weight | 502.12 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | [4-[[3-[3-[(4-boronobenzoyl)amino]-3-methylbutoxy]-3-phosphanylbutyl]carbamoyl]phenyl]boronic acid |
| SMILES | CC(C)(CCOC(C)(P)CCNC(=O)c1ccc(B(O)O)cc1)NC(=O)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C23H33B2N2O7P/c1-22(2,27-21(29)17-6-10-19(11-7-17)25(32)33)13-15-34-23(3,35)12-14-26-20(28)16-4-8-18(9-5-16)24(30)31/h4-11,30-33H,12-15,35H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | JAZWEFKGHXLCKD-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.12 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|