C15H17NO2 — CID 71138787
(5-cyclohexa-1,5-dien-1-yl-2H-pyrrol-2-yl) 2-methylbut-2-enoate (PubChem CID 71138787) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (5-cyclohexa-1,5-dien-1-yl-2H-pyrrol-2-yl) 2-methylbut-2-enoate.
| Compound Name | (5-cyclohexa-1,5-dien-1-yl-2H-pyrrol-2-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 71138787 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (5-cyclohexa-1,5-dien-1-yl-2H-pyrrol-2-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C=CC(C2=CCCC=C2)=N1 |
| InChI | InChI=1S/C15H17NO2/c1-3-11(2)15(17)18-14-10-9-13(16-14)12-7-5-4-6-8-12/h3,5,7-10,14H,4,6H2,1-2H3 |
| InChIKey | DAMVTHPKQYQGAF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|