C26H36N6O5 — CID 71142503
tert-butyl N-[1-[4-[[6-(2-morpholin-4-ylethylamino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamate (PubChem CID 71142503) has the molecular formula C26H36N6O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[[6-(2-morpholin-4-ylethylamino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[[6-(2-morpholin-4-ylethylamino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 71142503 |
| Molecular Formula | C26H36N6O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | tert-butyl N-[1-[4-[[6-(2-morpholin-4-ylethylamino)-3-nitro-2-pyridinyl]amino]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(Nc3nc(NCCN4CCOCC4)ccc3[N+](=O)[O-])cc2)CCC1 |
| InChI | InChI=1S/C26H36N6O5/c1-25(2,3)37-24(33)30-26(11-4-12-26)19-5-7-20(8-6-19)28-23-21(32(34)35)9-10-22(29-23)27-13-14-31-15-17-36-18-16-31/h5-10H,4,11-18H2,1-3H3,(H,30,33)(H2,27,28,29) |
| InChIKey | MPUSRNSGRZFDLR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|