C16H21N3O4 — CID 71145261
2-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]oxypyridine-3-carboxamide (PubChem CID 71145261) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]oxypyridine-3-carboxamide.
| Compound Name | 2-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 71145261 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]oxypyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1O[C@@H]1CCN(C(=O)C2CCOCC2)C1 |
| InChI | InChI=1S/C16H21N3O4/c17-14(20)13-2-1-6-18-15(13)23-12-3-7-19(10-12)16(21)11-4-8-22-9-5-11/h1-2,6,11-12H,3-5,7-10H2,(H2,17,20)/t12-/m1/s1 |
| InChIKey | WWGBQQAYGGIFKV-GFCCVEGCSA-N |
| XLogP | 0.59 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |