C20H20F3N3O4 — CID 71148613
N-[(1-methyl-5-nitro-3-phenylindol-2-yl)methyl]ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 71148613) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is N-[(1-methyl-5-nitro-3-phenylindol-2-yl)methyl]ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(1-methyl-5-nitro-3-phenylindol-2-yl)methyl]ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71148613 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[(1-methyl-5-nitro-3-phenylindol-2-yl)methyl]ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CCNCc1c(-c2ccccc2)c2cc([N+](=O)[O-])ccc2n1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19N3O2.C2HF3O2/c1-3-19-12-17-18(13-7-5-4-6-8-13)15-11-14(21(22)23)9-10-16(15)20(17)2;3-2(4,5)1(6)7/h4-11,19H,3,12H2,1-2H3;(H,6,7) |
| InChIKey | VAZYPMMXNVAJCM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|