C24H26N2O4 — CID 71148690
methyl 2-[5-(4-benzylpiperidine-1-carbonyl)-2,3-dihydro-1H-indol-3-yl]-2-oxoacetate (PubChem CID 71148690) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 2-[5-(4-benzylpiperidine-1-carbonyl)-2,3-dihydro-1H-indol-3-yl]-2-oxoacetate.
| Compound Name | methyl 2-[5-(4-benzylpiperidine-1-carbonyl)-2,3-dihydro-1H-indol-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 71148690 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl 2-[5-(4-benzylpiperidine-1-carbonyl)-2,3-dihydro-1H-indol-3-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1CNc2ccc(C(=O)N3CCC(Cc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C24H26N2O4/c1-30-24(29)22(27)20-15-25-21-8-7-18(14-19(20)21)23(28)26-11-9-17(10-12-26)13-16-5-3-2-4-6-16/h2-8,14,17,20,25H,9-13,15H2,1H3 |
| InChIKey | AILHWLFXQZQZAB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|