C22H24Cl2N2O2 — CID 71150812
4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxy-N-pentan-3-ylbenzamide (PubChem CID 71150812) has the molecular formula C22H24Cl2N2O2 and a molecular weight of 419.35 g/mol. Its IUPAC name is 4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxy-N-pentan-3-ylbenzamide.
| Compound Name | 4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxy-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 71150812 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxy-N-pentan-3-ylbenzamide |
| SMILES | CCOc1cc(C(=O)NC(CC)CC)ccc1-c1cc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H24Cl2N2O2/c1-4-15(5-2)25-22(27)13-7-8-16(21(11-13)28-6-3)20-10-14-9-17(23)18(24)12-19(14)26-20/h7-12,15,26H,4-6H2,1-3H3,(H,25,27) |
| InChIKey | ASTNKEMGPKDFNB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |