C22H16Cl2N4O — CID 71151908
N-(4-chlorophenyl)-2-[(4-chlorophenyl)-[(4-cyanophenyl)methyl]hydrazinylidene]acetamide (PubChem CID 71151908) has the molecular formula C22H16Cl2N4O and a molecular weight of 423.30 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(4-chlorophenyl)-[(4-cyanophenyl)methyl]hydrazinylidene]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(4-chlorophenyl)-[(4-cyanophenyl)methyl]hydrazinylidene]acetamide |
|---|---|
| PubChem CID | 71151908 |
| Molecular Formula | C22H16Cl2N4O |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(4-chlorophenyl)-[(4-cyanophenyl)methyl]hydrazinylidene]acetamide |
| SMILES | N#Cc1ccc(CN(N=CC(=O)Nc2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16Cl2N4O/c23-18-5-9-20(10-6-18)27-22(29)14-26-28(21-11-7-19(24)8-12-21)15-17-3-1-16(13-25)2-4-17/h1-12,14H,15H2,(H,27,29) |
| InChIKey | VNSIWPRLSHYOIE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|