C24H36O6 — CID 71151959
2-O-[3-[(3S,3aS,5aS,6R,9aS,9bS)-3-acetyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propyl] 1-O-ethyl oxalate (PubChem CID 71151959) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-O-[3-[(3S,3aS,5aS,6R,9aS,9bS)-3-acetyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propyl] 1-O-ethyl oxalate.
| Compound Name | 2-O-[3-[(3S,3aS,5aS,6R,9aS,9bS)-3-acetyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propyl] 1-O-ethyl oxalate |
|---|---|
| PubChem CID | 71151959 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-O-[3-[(3S,3aS,5aS,6R,9aS,9bS)-3-acetyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propyl] 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)OCCC[C@@]1(C)C(=O)CC[C@H]2[C@@H]3CC[C@H](C(C)=O)[C@@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C24H36O6/c1-5-29-21(27)22(28)30-14-6-12-24(4)19-11-13-23(3)17(15(2)25)8-9-18(23)16(19)7-10-20(24)26/h16-19H,5-14H2,1-4H3/t16-,17+,18-,19-,23+,24+/m0/s1 |
| InChIKey | AXJCPZXFXLEYEN-AKLHNQGLSA-N |
| XLogP | 3.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|