C12H24O11 — CID 71153395
2-[2-(1,2-dihydroxyethoxy)-3,4-dihydroxybutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71153395) has the molecular formula C12H24O11 and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-[2-(1,2-dihydroxyethoxy)-3,4-dihydroxybutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[2-(1,2-dihydroxyethoxy)-3,4-dihydroxybutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71153395 |
| Molecular Formula | C12H24O11 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[2-(1,2-dihydroxyethoxy)-3,4-dihydroxybutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC(O)OC(COC1OC(CO)C(O)C(O)C1O)C(O)CO |
| InChI | InChI=1S/C12H24O11/c13-1-5(16)7(22-8(17)3-15)4-21-12-11(20)10(19)9(18)6(2-14)23-12/h5-20H,1-4H2 |
| InChIKey | ISUXIIZDMSSOIB-UHFFFAOYSA-N |
| XLogP | -5.15 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | -5.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|