C14H17N3O3S — CID 71154039
9-N-(2-methoxyethyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine (PubChem CID 71154039) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 9-N-(2-methoxyethyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine.
| Compound Name | 9-N-(2-methoxyethyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine |
|---|---|
| PubChem CID | 71154039 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 9-N-(2-methoxyethyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine |
| SMILES | COCCNc1c(N)cnc2ccc3c(c12)CCS3(=O)=O |
| InChI | InChI=1S/C14H17N3O3S/c1-20-6-5-16-14-10(15)8-17-11-2-3-12-9(13(11)14)4-7-21(12,18)19/h2-3,8H,4-7,15H2,1H3,(H,16,17) |
| InChIKey | XNAUZTBFYMGPLW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|