C9H15N3O3S — CID 63049908
N-(2-methoxyethyl)-5,5-dioxo-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine (PubChem CID 63049908) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5,5-dioxo-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine.
| Compound Name | N-(2-methoxyethyl)-5,5-dioxo-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine |
|---|---|
| PubChem CID | 63049908 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(2-methoxyethyl)-5,5-dioxo-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine |
| SMILES | COCCNc1n[nH]c2c1CS(=O)(=O)CC2 |
| InChI | InChI=1S/C9H15N3O3S/c1-15-4-3-10-9-7-6-16(13,14)5-2-8(7)11-12-9/h2-6H2,1H3,(H2,10,11,12) |
| InChIKey | PXRNPCMGINDVTD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|