C7H9BN4O — CID 162381628
CID 162381628 (PubChem CID 162381628) has the molecular formula C7H9BN4O and a molecular weight of 175.99 g/mol.
| Compound Name | CID 162381628 |
|---|---|
| PubChem CID | 162381628 |
| Molecular Formula | C7H9BN4O |
| Molecular Weight | 175.99 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | — |
| SMILES | [B]c1[nH]nc(NCCOC)c1C#N |
| InChI | InChI=1S/C7H9BN4O/c1-13-3-2-10-7-5(4-9)6(8)11-12-7/h2-3H2,1H3,(H2,10,11,12) |
| InChIKey | AYOAUSZJUAGWAG-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.99 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|