C12H21N3O — CID 64760109
N-(2-methoxyethyl)-5,7-dimethyl-4,5,6,7-tetrahydro-1H-indazol-3-amine (PubChem CID 64760109) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5,7-dimethyl-4,5,6,7-tetrahydro-1H-indazol-3-amine.
| Compound Name | N-(2-methoxyethyl)-5,7-dimethyl-4,5,6,7-tetrahydro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 64760109 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-(2-methoxyethyl)-5,7-dimethyl-4,5,6,7-tetrahydro-1H-indazol-3-amine |
| SMILES | COCCNc1n[nH]c2c1CC(C)CC2C |
| InChI | InChI=1S/C12H21N3O/c1-8-6-9(2)11-10(7-8)12(15-14-11)13-4-5-16-3/h8-9H,4-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | ANNMZONFFKBDJY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|