C11H19N7O — CID 110913352
2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1-(2-methoxyethyl)guanidine (PubChem CID 110913352) has the molecular formula C11H19N7O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1-(2-methoxyethyl)guanidine.
| Compound Name | 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 110913352 |
| Molecular Formula | C11H19N7O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-1-(2-methoxyethyl)guanidine |
| SMILES | COCCN/C(N)=N/CCCc1[nH]nc(N)c1C#N |
| InChI | InChI=1S/C11H19N7O/c1-19-6-5-16-11(14)15-4-2-3-9-8(7-12)10(13)18-17-9/h2-6H2,1H3,(H3,13,17,18)(H3,14,15,16) |
| InChIKey | OUNXPGMLTCAADK-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|