C25H29N5O4 — CID 25371723
N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3,5-dimethoxy-4-phenylmethoxybenzamide (PubChem CID 25371723) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3,5-dimethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3,5-dimethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 25371723 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3,5-dimethoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCCCc2[nH]nc(N)c2C#N)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H29N5O4/c1-32-21-13-18(14-22(33-2)23(21)34-16-17-9-5-3-6-10-17)25(31)28-12-8-4-7-11-20-19(15-26)24(27)30-29-20/h3,5-6,9-10,13-14H,4,7-8,11-12,16H2,1-2H3,(H,28,31)(H3,27,29,30) |
| InChIKey | XVTOJPBCRAZHQY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|