C21H23N5O2 — CID 8929450
N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 8929450) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 8929450 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NCCCCCc1[nH]nc(N)c1C#N |
| InChI | InChI=1S/C21H23N5O2/c1-28-19-12-15-8-5-4-7-14(15)11-16(19)21(27)24-10-6-2-3-9-18-17(13-22)20(23)26-25-18/h4-5,7-8,11-12H,2-3,6,9-10H2,1H3,(H,24,27)(H3,23,25,26) |
| InChIKey | VITGMJMBCHYONQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|