C16H25N5O — CID 8929445
N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]cyclohexanecarboxamide (PubChem CID 8929445) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]cyclohexanecarboxamide.
| Compound Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 8929445 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]cyclohexanecarboxamide |
| SMILES | N#Cc1c(N)n[nH]c1CCCCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H25N5O/c17-11-13-14(20-21-15(13)18)9-5-2-6-10-19-16(22)12-7-3-1-4-8-12/h12H,1-10H2,(H,19,22)(H3,18,20,21) |
| InChIKey | DVXOIBYPSPGPTI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|