C19H32N6O — CID 47086932
N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-4-propylazepane-1-carboxamide (PubChem CID 47086932) has the molecular formula C19H32N6O and a molecular weight of 360.51 g/mol. Its IUPAC name is N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-4-propylazepane-1-carboxamide.
| Compound Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-4-propylazepane-1-carboxamide |
|---|---|
| PubChem CID | 47086932 |
| Molecular Formula | C19H32N6O |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | N-[5-(3-amino-4-cyano-1H-pyrazol-5-yl)pentyl]-4-propylazepane-1-carboxamide |
| SMILES | CCCC1CCCN(C(=O)NCCCCCc2[nH]nc(N)c2C#N)CC1 |
| InChI | InChI=1S/C19H32N6O/c1-2-7-15-8-6-12-25(13-10-15)19(26)22-11-5-3-4-9-17-16(14-20)18(21)24-23-17/h15H,2-13H2,1H3,(H,22,26)(H3,21,23,24) |
| InChIKey | CRZKFNUPAAVBJP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|